C58H36O8 — CID 166638041
5-[4-[1,2,2-tris[4-(3,5-diformylphenyl)phenyl]ethenyl]phenyl]benzene-1,3-dicarbaldehyde (PubChem CID 166638041) has the molecular formula C58H36O8 and a molecular weight of 860.92 g/mol. Its IUPAC name is 5-[4-[1,2,2-tris[4-(3,5-diformylphenyl)phenyl]ethenyl]phenyl]benzene-1,3-dicarbaldehyde.
| Compound Name | 5-[4-[1,2,2-tris[4-(3,5-diformylphenyl)phenyl]ethenyl]phenyl]benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 166638041 |
| Molecular Formula | C58H36O8 |
| Molecular Weight | 860.92 g/mol |
| Exact Mass | 860.24 |
| IUPAC Name | 5-[4-[1,2,2-tris[4-(3,5-diformylphenyl)phenyl]ethenyl]phenyl]benzene-1,3-dicarbaldehyde |
| SMILES | O=Cc1cc(C=O)cc(-c2ccc(C(=C(c3ccc(-c4cc(C=O)cc(C=O)c4)cc3)c3ccc(-c4cc(C=O)cc(C=O)c4)cc3)c3ccc(-c4cc(C=O)cc(C=O)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C58H36O8/c59-29-37-17-38(30-60)22-53(21-37)45-1-9-49(10-2-45)57(50-11-3-46(4-12-50)54-23-39(31-61)18-40(24-54)32-62)58(51-13-5-47(6-14-51)55-25-41(33-63)19-42(26-55)34-64)52-15-7-48(8-16-52)56-27-43(35-65)20-44(28-56)36-66/h1-36H |
| InChIKey | ZWBOLASMDJUAGB-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.92 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|