C15H25N3O4S — CID 166638175
(2R,4S)-2-[(1R)-2-(azepan-1-yl)-1-formamido-2-oxoethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 166638175) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is (2R,4S)-2-[(1R)-2-(azepan-1-yl)-1-formamido-2-oxoethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4S)-2-[(1R)-2-(azepan-1-yl)-1-formamido-2-oxoethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 166638175 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2R,4S)-2-[(1R)-2-(azepan-1-yl)-1-formamido-2-oxoethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1(C)S[C@H]([C@H](NC=O)C(=O)N2CCCCCC2)N[C@H]1C(=O)O |
| InChI | InChI=1S/C15H25N3O4S/c1-15(2)11(14(21)22)17-12(23-15)10(16-9-19)13(20)18-7-5-3-4-6-8-18/h9-12,17H,3-8H2,1-2H3,(H,16,19)(H,21,22)/t10-,11-,12+/m0/s1 |
| InChIKey | PMJUGUXXJDBOJL-SDDRHHMPSA-N |
| XLogP | 0.40 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|