C29H38FN7O5 — CID 166638731
[(E,2S)-7-(dimethylamino)-1-[[4-[[4-(2,2-dimethylpropyl)-6-fluoro-1H-benzimidazol-2-yl]methyl]-3-oxopyrazin-2-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 166638731) has the molecular formula C29H38FN7O5 and a molecular weight of 583.67 g/mol. Its IUPAC name is [(E,2S)-7-(dimethylamino)-1-[[4-[[4-(2,2-dimethylpropyl)-6-fluoro-1H-benzimidazol-2-yl]methyl]-3-oxopyrazin-2-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-7-(dimethylamino)-1-[[4-[[4-(2,2-dimethylpropyl)-6-fluoro-1H-benzimidazol-2-yl]methyl]-3-oxopyrazin-2-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 166638731 |
| Molecular Formula | C29H38FN7O5 |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | [(E,2S)-7-(dimethylamino)-1-[[4-[[4-(2,2-dimethylpropyl)-6-fluoro-1H-benzimidazol-2-yl]methyl]-3-oxopyrazin-2-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](OC(=O)N(C)C)C(=O)Nc1nccn(Cc2nc3c(CC(C)(C)C)cc(F)cc3[nH]2)c1=O |
| InChI | InChI=1S/C29H38FN7O5/c1-29(2,3)16-18-14-19(30)15-20-24(18)33-22(32-20)17-37-13-12-31-25(27(37)40)34-26(39)21(42-28(41)36(6)7)10-8-9-11-23(38)35(4)5/h9,11-15,21H,8,10,16-17H2,1-7H3,(H,32,33)(H,31,34,39)/b11-9+/t21-/m0/s1 |
| InChIKey | HXUIXKQBVFEXOS-ZUURVNMSSA-N |
| XLogP | 3.33 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|