C15H11NO6 — CID 16663882
ethyl 7-methyl-1,2,4-trioxopyrrolo[2,1-c][1,4]benzoxazine-3-carboxylate (PubChem CID 16663882) has the molecular formula C15H11NO6 and a molecular weight of 301.25 g/mol. Its IUPAC name is ethyl 7-methyl-1,2,4-trioxopyrrolo[2,1-c][1,4]benzoxazine-3-carboxylate.
| Compound Name | ethyl 7-methyl-1,2,4-trioxopyrrolo[2,1-c][1,4]benzoxazine-3-carboxylate |
|---|---|
| PubChem CID | 16663882 |
| Molecular Formula | C15H11NO6 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | ethyl 7-methyl-1,2,4-trioxopyrrolo[2,1-c][1,4]benzoxazine-3-carboxylate |
| SMILES | CCOC(=O)C1=C2C(=O)Oc3cc(C)ccc3N2C(=O)C1=O |
| InChI | InChI=1S/C15H11NO6/c1-3-21-14(19)10-11-15(20)22-9-6-7(2)4-5-8(9)16(11)13(18)12(10)17/h4-6H,3H2,1-2H3 |
| InChIKey | OPRPFQIADAZMAN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|