C33H40O7 — CID 166639476
(1R,3S,4R,14S,17Z,20R)-3,9,25-trihydroxy-4,11,16,16,20,27-hexamethyl-5,21-dioxapentacyclo[18.9.0.04,14.06,12.022,28]nonacosa-6,9,11,17,22,25,27-heptaene-8,24-dione (PubChem CID 166639476) has the molecular formula C33H40O7 and a molecular weight of 548.68 g/mol. Its IUPAC name is (1R,3S,4R,14S,17Z,20R)-3,9,25-trihydroxy-4,11,16,16,20,27-hexamethyl-5,21-dioxapentacyclo[18.9.0.04,14.06,12.022,28]nonacosa-6,9,11,17,22,25,27-heptaene-8,24-dione.
| Compound Name | (1R,3S,4R,14S,17Z,20R)-3,9,25-trihydroxy-4,11,16,16,20,27-hexamethyl-5,21-dioxapentacyclo[18.9.0.04,14.06,12.022,28]nonacosa-6,9,11,17,22,25,27-heptaene-8,24-dione |
|---|---|
| PubChem CID | 166639476 |
| Molecular Formula | C33H40O7 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | (1R,3S,4R,14S,17Z,20R)-3,9,25-trihydroxy-4,11,16,16,20,27-hexamethyl-5,21-dioxapentacyclo[18.9.0.04,14.06,12.022,28]nonacosa-6,9,11,17,22,25,27-heptaene-8,24-dione |
| SMILES | Cc1cc(O)c(=O)cc2c1C[C@@H]1CC(C)(C)/C=C\C[C@@]3(C)Oc4cc(=O)c(O)cc(C)c4C[C@@H]3C[C@H](O)[C@]1(C)O2 |
| InChI | InChI=1S/C33H40O7/c1-18-10-24(34)26(36)15-28-22(18)12-20-14-30(38)33(6)21(17-31(3,4)8-7-9-32(20,5)39-28)13-23-19(2)11-25(35)27(37)16-29(23)40-33/h7-8,10-11,15-16,20-21,30,38H,9,12-14,17H2,1-6H3,(H,34,36)(H,35,37)/b8-7-/t20-,21-,30+,32-,33-/m1/s1 |
| InChIKey | BWTQHPFSWXJOGP-PFOGLZIESA-N |
| XLogP | 4.88 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|