About 3-methyloctane
3-methyloctane (PubChem CID 16664) has the molecular formula C9H20
and a molecular weight of 128.26 g/mol. Its IUPAC name is 3-methyloctane.
Molecular Properties
| Compound Name | 3-methyloctane |
| PubChem CID | 16664 |
| Molecular Formula | C9H20 |
| Molecular Weight | 128.26 g/mol |
| Exact Mass | 128.16 |
| IUPAC Name | 3-methyloctane |
| SMILES | CCCCCC(C)CC |
| InChI | InChI=1S/C9H20/c1-4-6-7-8-9(3)5-2/h9H,4-8H2,1-3H3 |
| InChIKey | SEEOMASXHIJCDV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyloctane?
The IUPAC name of 3-methyloctane (CID 16664) is 3-methyloctane.
What is the SMILES notation for 3-methyloctane?
The canonical SMILES for 3-methyloctane is CCCCCC(C)CC.
What is the InChIKey of 3-methyloctane?
The InChIKey is SEEOMASXHIJCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20/c1-4-6-7-8-9(3)5-2/h9H,4-8H2,1-3H3.
What are the key properties of 3-methyloctane?
3-methyloctane has a molecular weight of 128.26 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyloctane is sourced from PubChem (CID 16664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).