C22H31NO5S — CID 166640061
(4R)-4-[(1R,4E,8Z,10E,12S,17R)-17-hydroxy-5,12-dimethyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one (PubChem CID 166640061) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is (4R)-4-[(1R,4E,8Z,10E,12S,17R)-17-hydroxy-5,12-dimethyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one.
| Compound Name | (4R)-4-[(1R,4E,8Z,10E,12S,17R)-17-hydroxy-5,12-dimethyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 166640061 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (4R)-4-[(1R,4E,8Z,10E,12S,17R)-17-hydroxy-5,12-dimethyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-1,3-thiazolidin-2-one |
| SMILES | C/C1=C\C(=O)O[C@@H]2CC(CC[C@H](C)/C=C/C=C\CC1)O[C@@](O)([C@@H]1CSC(=O)N1)C2 |
| InChI | InChI=1S/C22H31NO5S/c1-15-7-5-3-4-6-8-16(2)11-20(24)27-18-12-17(10-9-15)28-22(26,13-18)19-14-29-21(25)23-19/h3-5,7,11,15,17-19,26H,6,8-10,12-14H2,1-2H3,(H,23,25)/b4-3-,7-5+,16-11+/t15-,17?,18-,19+,22-/m1/s1 |
| InChIKey | DDVBPZROPPMBLW-LCAOMDHLSA-N |
| XLogP | 3.86 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|