C11H18BClN2O2 — CID 166640266
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine;hydrochloride (PubChem CID 166640266) has the molecular formula C11H18BClN2O2 and a molecular weight of 256.54 g/mol. Its IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine;hydrochloride.
| Compound Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 166640266 |
| Molecular Formula | C11H18BClN2O2 |
| Molecular Weight | 256.54 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine;hydrochloride |
| SMILES | CC1(C)OB(c2cnccc2N)OC1(C)C.Cl |
| InChI | InChI=1S/C11H17BN2O2.ClH/c1-10(2)11(3,4)16-12(15-10)8-7-14-6-5-9(8)13;/h5-7H,1-4H3,(H2,13,14);1H |
| InChIKey | IPQLIMWNUXNFCN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.54 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|