C11H10BNO3S3 — CID 166640374
[5-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]boronic acid (PubChem CID 166640374) has the molecular formula C11H10BNO3S3 and a molecular weight of 311.22 g/mol. Its IUPAC name is [5-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]boronic acid.
| Compound Name | [5-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]boronic acid |
|---|---|
| PubChem CID | 166640374 |
| Molecular Formula | C11H10BNO3S3 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | [5-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]boronic acid |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(B(O)O)s2)SC1=S |
| InChI | InChI=1S/C11H10BNO3S3/c1-2-5-13-10(14)8(19-11(13)17)6-7-3-4-9(18-7)12(15)16/h2-4,6,15-16H,1,5H2/b8-6- |
| InChIKey | GMGOGGXHSYGCAK-VURMDHGXSA-N |
| XLogP | 0.82 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|