C11H9ClF4O — CID 166640748
1-[2,5-bis(difluoromethyl)phenyl]-2-chloropropan-1-one (PubChem CID 166640748) has the molecular formula C11H9ClF4O and a molecular weight of 268.64 g/mol. Its IUPAC name is 1-[2,5-bis(difluoromethyl)phenyl]-2-chloropropan-1-one.
| Compound Name | 1-[2,5-bis(difluoromethyl)phenyl]-2-chloropropan-1-one |
|---|---|
| PubChem CID | 166640748 |
| Molecular Formula | C11H9ClF4O |
| Molecular Weight | 268.64 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 1-[2,5-bis(difluoromethyl)phenyl]-2-chloropropan-1-one |
| SMILES | CC(Cl)C(=O)c1cc(C(F)F)ccc1C(F)F |
| InChI | InChI=1S/C11H9ClF4O/c1-5(12)9(17)8-4-6(10(13)14)2-3-7(8)11(15)16/h2-5,10-11H,1H3 |
| InChIKey | NFUQEEFJFBOZCT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|