C13H17ClO3 — CID 166641878
1-chloro-1-(2,5-diethoxyphenyl)propan-2-one (PubChem CID 166641878) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is 1-chloro-1-(2,5-diethoxyphenyl)propan-2-one.
| Compound Name | 1-chloro-1-(2,5-diethoxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 166641878 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-chloro-1-(2,5-diethoxyphenyl)propan-2-one |
| SMILES | CCOc1ccc(OCC)c(C(Cl)C(C)=O)c1 |
| InChI | InChI=1S/C13H17ClO3/c1-4-16-10-6-7-12(17-5-2)11(8-10)13(14)9(3)15/h6-8,13H,4-5H2,1-3H3 |
| InChIKey | VMGSJIKYDZPGFV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|