C19H21N — CID 166642362
2,2-dideuterio-3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propan-1-amine (PubChem CID 166642362) has the molecular formula C19H21N and a molecular weight of 265.40 g/mol. Its IUPAC name is 2,2-dideuterio-3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propan-1-amine.
| Compound Name | 2,2-dideuterio-3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propan-1-amine |
|---|---|
| PubChem CID | 166642362 |
| Molecular Formula | C19H21N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2,2-dideuterio-3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propan-1-amine |
| SMILES | [2H]C([2H])(CN)CC12CCC(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C19H21N/c20-13-5-11-19-12-10-14(15-6-1-3-8-17(15)19)16-7-2-4-9-18(16)19/h1-4,6-9,14H,5,10-13,20H2/i5D2 |
| InChIKey | IFHUOEQJTQWFGJ-BFWBPSQCSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |