C21H40O3Si — CID 16664237
(2E,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-4-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]butane-1,3-diol (PubChem CID 16664237) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (2E,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-4-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]butane-1,3-diol.
| Compound Name | (2E,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-4-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]butane-1,3-diol |
|---|---|
| PubChem CID | 16664237 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (2E,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-4-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]butane-1,3-diol |
| SMILES | C=C1CCCC(C)(C)[C@@H]1C[C@@H](O)/C(=C/CO[Si](C)(C)C(C)(C)C)CO |
| InChI | InChI=1S/C21H40O3Si/c1-16-10-9-12-21(5,6)18(16)14-19(23)17(15-22)11-13-24-25(7,8)20(2,3)4/h11,18-19,22-23H,1,9-10,12-15H2,2-8H3/b17-11+/t18-,19-/m1/s1 |
| InChIKey | MPUWARBCVQQPLW-CDEWEUSKSA-N |
| XLogP | 5.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|