C8H15Br3 — CID 166642867
1,2,8-tribromooctane (PubChem CID 166642867) has the molecular formula C8H15Br3 and a molecular weight of 350.92 g/mol. Its IUPAC name is 1,2,8-tribromooctane.
| Compound Name | 1,2,8-tribromooctane |
|---|---|
| PubChem CID | 166642867 |
| Molecular Formula | C8H15Br3 |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 347.87 |
| IUPAC Name | 1,2,8-tribromooctane |
| SMILES | BrCCCCCCC(Br)CBr |
| InChI | InChI=1S/C8H15Br3/c9-6-4-2-1-3-5-8(11)7-10/h8H,1-7H2 |
| InChIKey | AVXMMJVNMXWXTM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|