C39H28BN3O — CID 166642908
N,N-diphenyl-4-[(1S)-1-phenyl-18-oxa-2-aza-19-azonia-1-boranuidapentacyclo[9.7.1.02,6.08,19.012,17]nonadeca-3,5,7,9,11(19),12,14,16-octaen-7-yl]aniline (PubChem CID 166642908) has the molecular formula C39H28BN3O and a molecular weight of 565.49 g/mol. Its IUPAC name is N,N-diphenyl-4-[(1S)-1-phenyl-18-oxa-2-aza-19-azonia-1-boranuidapentacyclo[9.7.1.02,6.08,19.012,17]nonadeca-3,5,7,9,11(19),12,14,16-octaen-7-yl]aniline.
| Compound Name | N,N-diphenyl-4-[(1S)-1-phenyl-18-oxa-2-aza-19-azonia-1-boranuidapentacyclo[9.7.1.02,6.08,19.012,17]nonadeca-3,5,7,9,11(19),12,14,16-octaen-7-yl]aniline |
|---|---|
| PubChem CID | 166642908 |
| Molecular Formula | C39H28BN3O |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | N,N-diphenyl-4-[(1S)-1-phenyl-18-oxa-2-aza-19-azonia-1-boranuidapentacyclo[9.7.1.02,6.08,19.012,17]nonadeca-3,5,7,9,11(19),12,14,16-octaen-7-yl]aniline |
| SMILES | C1=CC2=[N+]3C1=C(c1ccc(N(c4ccccc4)c4ccccc4)cc1)c1cccn1[B@-]3(c1ccccc1)Oc1ccccc12 |
| InChI | InChI=1S/C39H28BN3O/c1-4-13-30(14-5-1)40-41-28-12-20-36(41)39(37-27-26-35(43(37)40)34-19-10-11-21-38(34)44-40)29-22-24-33(25-23-29)42(31-15-6-2-7-16-31)32-17-8-3-9-18-32/h1-28H/t40-/m0/s1 |
| InChIKey | JMNRMWCHCJUVOM-FAIXQHPJSA-N |
| XLogP | 7.89 |
| TPSA | 20.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|