About tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane
tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane (PubChem CID 166643188) has the molecular formula C36H51F2Sb
and a molecular weight of 643.56 g/mol. Its IUPAC name is tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane.
Molecular Properties
| Compound Name | tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane |
| PubChem CID | 166643188 |
| Molecular Formula | C36H51F2Sb |
| Molecular Weight | 643.56 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane |
| SMILES | CC(C)c1cccc(C(C)C)c1[Sb](F)(F)(c1c(C(C)C)cccc1C(C)C)c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/3C12H17.2FH.Sb/c3*1-9(2)11-6-5-7-12(8-11)10(3)4;;;/h3*5-7,9-10H,1-4H3;2*1H;/q;;;;;+2/p-2 |
| InChIKey | JJGKGGJRTAZPFR-UHFFFAOYSA-L |
| XLogP | 9.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 643.56 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane?
The IUPAC name of tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane (CID 166643188) is tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane.
What is the SMILES notation for tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane?
The canonical SMILES for tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane is CC(C)c1cccc(C(C)C)c1[Sb](F)(F)(c1c(C(C)C)cccc1C(C)C)c1c(C(C)C)cccc1C(C)C.
What is the InChIKey of tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane?
The InChIKey is JJGKGGJRTAZPFR-UHFFFAOYSA-L. The full InChI is InChI=1S/3C12H17.2FH.Sb/c3*1-9(2)11-6-5-7-12(8-11)10(3)4;;;/h3*5-7,9-10H,1-4H3;2*1H;/q;;;;;+2/p-2.
What are the key properties of tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane?
tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane has a molecular weight of 643.56 g/mol, XLogP of 9.78, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris[2,6-di(propan-2-yl)phenyl]-difluoro-λ5-stibane is sourced from PubChem (CID 166643188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).