C10H15N5O — CID 166643227
5-(butylamino)-2-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 166643227) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 5-(butylamino)-2-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-(butylamino)-2-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 166643227 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 5-(butylamino)-2-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCCCNc1cc(=O)n2[nH]c(C)nc2n1 |
| InChI | InChI=1S/C10H15N5O/c1-3-4-5-11-8-6-9(16)15-10(13-8)12-7(2)14-15/h6,11H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | SROVRWMEKGAVEY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|