About 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde
4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde (PubChem CID 166643289) has the molecular formula C20H12N2O2S
and a molecular weight of 344.40 g/mol. Its IUPAC name is 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde |
| PubChem CID | 166643289 |
| Molecular Formula | C20H12N2O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(-c3ccc(C=O)cc3)c3snnc23)cc1 |
| InChI | InChI=1S/C20H12N2O2S/c23-11-13-1-5-15(6-2-13)17-9-10-18(20-19(17)21-22-25-20)16-7-3-14(12-24)4-8-16/h1-12H |
| InChIKey | ABQBXPYNBRHGHW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde?
The IUPAC name of 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde (CID 166643289) is 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde.
What is the SMILES notation for 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde?
The canonical SMILES for 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde is O=Cc1ccc(-c2ccc(-c3ccc(C=O)cc3)c3snnc23)cc1.
What is the InChIKey of 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde?
The InChIKey is ABQBXPYNBRHGHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N2O2S/c23-11-13-1-5-15(6-2-13)17-9-10-18(20-19(17)21-22-25-20)16-7-3-14(12-24)4-8-16/h1-12H.
What are the key properties of 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde?
4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde has a molecular weight of 344.40 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[7-(4-formylphenyl)-1,2,3-benzothiadiazol-4-yl]benzaldehyde is sourced from PubChem (CID 166643289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).