C28H35F3O4 — CID 166643312
5-(1-adamantyl)-7-tert-butyl-3,3-dimethoxy-1-(trifluoromethyl)-3a,9-dihydrofuro[3,4-b]chromene (PubChem CID 166643312) has the molecular formula C28H35F3O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is 5-(1-adamantyl)-7-tert-butyl-3,3-dimethoxy-1-(trifluoromethyl)-3a,9-dihydrofuro[3,4-b]chromene.
| Compound Name | 5-(1-adamantyl)-7-tert-butyl-3,3-dimethoxy-1-(trifluoromethyl)-3a,9-dihydrofuro[3,4-b]chromene |
|---|---|
| PubChem CID | 166643312 |
| Molecular Formula | C28H35F3O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 5-(1-adamantyl)-7-tert-butyl-3,3-dimethoxy-1-(trifluoromethyl)-3a,9-dihydrofuro[3,4-b]chromene |
| SMILES | COC1(OC)OC(C(F)(F)F)=C2Cc3cc(C(C)(C)C)cc(C45CC6CC(CC(C6)C4)C5)c3OC21 |
| InChI | InChI=1S/C28H35F3O4/c1-25(2,3)19-9-18-10-20-23(27(29,30)31)35-28(32-4,33-5)24(20)34-22(18)21(11-19)26-12-15-6-16(13-26)8-17(7-15)14-26/h9,11,15-17,24H,6-8,10,12-14H2,1-5H3 |
| InChIKey | CKUVURPQTGYAIB-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|