C26H32N4O3 — CID 166643545
1-[4-(2-ethoxyethylamino)-5-(6-ethoxynaphthalen-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-methylpropan-2-ol (PubChem CID 166643545) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-[4-(2-ethoxyethylamino)-5-(6-ethoxynaphthalen-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-(2-ethoxyethylamino)-5-(6-ethoxynaphthalen-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 166643545 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-[4-(2-ethoxyethylamino)-5-(6-ethoxynaphthalen-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-methylpropan-2-ol |
| SMILES | CCOCCNc1ncnc2c1c(-c1ccc3cc(OCC)ccc3c1)cn2CC(C)(C)O |
| InChI | InChI=1S/C26H32N4O3/c1-5-32-12-11-27-24-23-22(15-30(16-26(3,4)31)25(23)29-17-28-24)20-8-7-19-14-21(33-6-2)10-9-18(19)13-20/h7-10,13-15,17,31H,5-6,11-12,16H2,1-4H3,(H,27,28,29) |
| InChIKey | OWOVLVIZJKGTON-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|