About 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid
2-cyclohexa-1,4-dien-1-ylethylcarbamic acid (PubChem CID 166643590) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid.
Molecular Properties
| Compound Name | 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid |
| PubChem CID | 166643590 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid |
| SMILES | O=C(O)NCCC1=CCC=CC1 |
| InChI | InChI=1S/C9H13NO2/c11-9(12)10-7-6-8-4-2-1-3-5-8/h1-2,5,10H,3-4,6-7H2,(H,11,12) |
| InChIKey | ADDPYVAGEBURFG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid?
The IUPAC name of 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid (CID 166643590) is 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid.
What is the SMILES notation for 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid?
The canonical SMILES for 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid is O=C(O)NCCC1=CCC=CC1.
What is the InChIKey of 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid?
The InChIKey is ADDPYVAGEBURFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c11-9(12)10-7-6-8-4-2-1-3-5-8/h1-2,5,10H,3-4,6-7H2,(H,11,12).
What are the key properties of 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid?
2-cyclohexa-1,4-dien-1-ylethylcarbamic acid has a molecular weight of 167.21 g/mol, XLogP of 1.92, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,4-dien-1-ylethylcarbamic acid is sourced from PubChem (CID 166643590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).