C24H29F7N2O4 — CID 166643644
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(cyclopentanecarbonyloxy)-3-fluorophenyl]methyl-methylamino]-4-methylpiperidine-1-carboxylate (PubChem CID 166643644) has the molecular formula C24H29F7N2O4 and a molecular weight of 542.49 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(cyclopentanecarbonyloxy)-3-fluorophenyl]methyl-methylamino]-4-methylpiperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(cyclopentanecarbonyloxy)-3-fluorophenyl]methyl-methylamino]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 166643644 |
| Molecular Formula | C24H29F7N2O4 |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(cyclopentanecarbonyloxy)-3-fluorophenyl]methyl-methylamino]-4-methylpiperidine-1-carboxylate |
| SMILES | CN(Cc1cccc(F)c1OC(=O)C1CCCC1)C1(C)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H29F7N2O4/c1-22(10-12-33(13-11-22)21(35)37-20(23(26,27)28)24(29,30)31)32(2)14-16-8-5-9-17(25)18(16)36-19(34)15-6-3-4-7-15/h5,8-9,15,20H,3-4,6-7,10-14H2,1-2H3 |
| InChIKey | ZAHUGLAJVVYPPS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|