C12H15F3N2O5S — CID 166644189
[(2S,4S)-4-[[5-(trifluoromethoxy)-2-pyridinyl]oxy]pyrrolidin-2-yl]methyl methanesulfonate (PubChem CID 166644189) has the molecular formula C12H15F3N2O5S and a molecular weight of 356.32 g/mol. Its IUPAC name is [(2S,4S)-4-[[5-(trifluoromethoxy)-2-pyridinyl]oxy]pyrrolidin-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,4S)-4-[[5-(trifluoromethoxy)-2-pyridinyl]oxy]pyrrolidin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 166644189 |
| Molecular Formula | C12H15F3N2O5S |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | [(2S,4S)-4-[[5-(trifluoromethoxy)-2-pyridinyl]oxy]pyrrolidin-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1C[C@H](Oc2ccc(OC(F)(F)F)cn2)CN1 |
| InChI | InChI=1S/C12H15F3N2O5S/c1-23(18,19)20-7-8-4-10(6-16-8)21-11-3-2-9(5-17-11)22-12(13,14)15/h2-3,5,8,10,16H,4,6-7H2,1H3/t8-,10-/m0/s1 |
| InChIKey | MKVOSAXJBBNNNL-WPRPVWTQSA-N |
| XLogP | 1.07 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|