C16H23F2NO2 — CID 166644787
tert-butyl (2R)-2-[(3E,5E)-3,6-difluorohepta-1,3,5-trien-2-yl]pyrrolidine-1-carboxylate (PubChem CID 166644787) has the molecular formula C16H23F2NO2 and a molecular weight of 299.36 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(3E,5E)-3,6-difluorohepta-1,3,5-trien-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(3E,5E)-3,6-difluorohepta-1,3,5-trien-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166644787 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | tert-butyl (2R)-2-[(3E,5E)-3,6-difluorohepta-1,3,5-trien-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C=C(/C(F)=C\C=C(/C)F)[C@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23F2NO2/c1-11(17)8-9-13(18)12(2)14-7-6-10-19(14)15(20)21-16(3,4)5/h8-9,14H,2,6-7,10H2,1,3-5H3/b11-8+,13-9+/t14-/m1/s1 |
| InChIKey | SZNJYAGZUHYFFM-CDBHNHRVSA-N |
| XLogP | 4.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|