About [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol
[4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol (PubChem CID 166644981) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol |
| PubChem CID | 166644981 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol |
| SMILES | CN[C@]1(CO)CC[C@@H](c2ccc(CO)cc2)C1 |
| InChI | InChI=1S/C14H21NO2/c1-15-14(10-17)7-6-13(8-14)12-4-2-11(9-16)3-5-12/h2-5,13,15-17H,6-10H2,1H3/t13-,14-/m1/s1 |
| InChIKey | HFHFRAHQVJUFCH-ZIAGYGMSSA-N |
| XLogP | 1.40 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol?
The IUPAC name of [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol (CID 166644981) is [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol.
What is the SMILES notation for [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol?
The canonical SMILES for [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol is CN[C@]1(CO)CC[C@@H](c2ccc(CO)cc2)C1.
What is the InChIKey of [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol?
The InChIKey is HFHFRAHQVJUFCH-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H21NO2/c1-15-14(10-17)7-6-13(8-14)12-4-2-11(9-16)3-5-12/h2-5,13,15-17H,6-10H2,1H3/t13-,14-/m1/s1.
What are the key properties of [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol?
[4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol has a molecular weight of 235.33 g/mol, XLogP of 1.40, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1R,3R)-3-(hydroxymethyl)-3-(methylamino)cyclopentyl]phenyl]methanol is sourced from PubChem (CID 166644981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).