C19H34N6 — CID 166645101
1-(3-methylbutan-2-yl)-4-[4-methyl-5-[4-(2-methylpropyl)triazol-1-yl]pentyl]triazole (PubChem CID 166645101) has the molecular formula C19H34N6 and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-(3-methylbutan-2-yl)-4-[4-methyl-5-[4-(2-methylpropyl)triazol-1-yl]pentyl]triazole.
| Compound Name | 1-(3-methylbutan-2-yl)-4-[4-methyl-5-[4-(2-methylpropyl)triazol-1-yl]pentyl]triazole |
|---|---|
| PubChem CID | 166645101 |
| Molecular Formula | C19H34N6 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.28 |
| IUPAC Name | 1-(3-methylbutan-2-yl)-4-[4-methyl-5-[4-(2-methylpropyl)triazol-1-yl]pentyl]triazole |
| SMILES | CC(C)Cc1cn(CC(C)CCCc2cn(C(C)C(C)C)nn2)nn1 |
| InChI | InChI=1S/C19H34N6/c1-14(2)10-19-12-24(22-21-19)11-16(5)8-7-9-18-13-25(23-20-18)17(6)15(3)4/h12-17H,7-11H2,1-6H3 |
| InChIKey | LRRGWZSVVPKSDW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |