C21H23ClN8O2 — CID 166645124
(7S)-2-[[1-[(2-chloro-4-pyridinyl)methyl]pyrazol-4-yl]methylamino]-7-(1-methoxyethenyl)-4,8-dimethyl-5,7-dihydropteridin-6-one (PubChem CID 166645124) has the molecular formula C21H23ClN8O2 and a molecular weight of 454.92 g/mol. Its IUPAC name is (7S)-2-[[1-[(2-chloro-4-pyridinyl)methyl]pyrazol-4-yl]methylamino]-7-(1-methoxyethenyl)-4,8-dimethyl-5,7-dihydropteridin-6-one.
| Compound Name | (7S)-2-[[1-[(2-chloro-4-pyridinyl)methyl]pyrazol-4-yl]methylamino]-7-(1-methoxyethenyl)-4,8-dimethyl-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 166645124 |
| Molecular Formula | C21H23ClN8O2 |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | (7S)-2-[[1-[(2-chloro-4-pyridinyl)methyl]pyrazol-4-yl]methylamino]-7-(1-methoxyethenyl)-4,8-dimethyl-5,7-dihydropteridin-6-one |
| SMILES | C=C(OC)[C@H]1C(=O)Nc2c(C)nc(NCc3cnn(Cc4ccnc(Cl)c4)c3)nc2N1C |
| InChI | InChI=1S/C21H23ClN8O2/c1-12-17-19(29(3)18(13(2)32-4)20(31)27-17)28-21(26-12)24-8-15-9-25-30(11-15)10-14-5-6-23-16(22)7-14/h5-7,9,11,18H,2,8,10H2,1,3-4H3,(H,27,31)(H,24,26,28)/t18-/m0/s1 |
| InChIKey | YKTXCMVAJOLTRH-SFHVURJKSA-N |
| XLogP | 2.61 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|