C21H20F3N7O — CID 166645180
(6aR)-4-methyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one (PubChem CID 166645180) has the molecular formula C21H20F3N7O and a molecular weight of 443.43 g/mol. Its IUPAC name is (6aR)-4-methyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one.
| Compound Name | (6aR)-4-methyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one |
|---|---|
| PubChem CID | 166645180 |
| Molecular Formula | C21H20F3N7O |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (6aR)-4-methyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one |
| SMILES | Cc1nc(NCc2cnn(Cc3cc(F)c(F)c(F)c3)c2)nc2c1NC(=O)[C@H]1CCCN21 |
| InChI | InChI=1S/C21H20F3N7O/c1-11-18-19(31-4-2-3-16(31)20(32)28-18)29-21(27-11)25-7-13-8-26-30(10-13)9-12-5-14(22)17(24)15(23)6-12/h5-6,8,10,16H,2-4,7,9H2,1H3,(H,28,32)(H,25,27,29)/t16-/m1/s1 |
| InChIKey | LZIPADHRFUCGKS-MRXNPFEDSA-N |
| XLogP | 2.98 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|