C17H22N2O — CID 166645558
(2E)-N-[(3Z,5Z)-5-cyclopropylhepta-1,3,5-trien-2-yl]-2-[(ethylideneamino)methylidene]but-3-enamide (PubChem CID 166645558) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (2E)-N-[(3Z,5Z)-5-cyclopropylhepta-1,3,5-trien-2-yl]-2-[(ethylideneamino)methylidene]but-3-enamide.
| Compound Name | (2E)-N-[(3Z,5Z)-5-cyclopropylhepta-1,3,5-trien-2-yl]-2-[(ethylideneamino)methylidene]but-3-enamide |
|---|---|
| PubChem CID | 166645558 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (2E)-N-[(3Z,5Z)-5-cyclopropylhepta-1,3,5-trien-2-yl]-2-[(ethylideneamino)methylidene]but-3-enamide |
| SMILES | C=C/C(=C\N=C\C)C(=O)NC(=C)/C=C\C(=C/C)C1CC1 |
| InChI | InChI=1S/C17H22N2O/c1-5-14(16-10-11-16)9-8-13(4)19-17(20)15(6-2)12-18-7-3/h5-9,12,16H,2,4,10-11H2,1,3H3,(H,19,20)/b9-8-,14-5+,15-12+,18-7+ |
| InChIKey | KYQVWAROISMLML-ZAKIXBRQSA-N |
| XLogP | 3.69 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|