About 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one
5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one (PubChem CID 166645867) has the molecular formula C7H11N3OS
and a molecular weight of 185.25 g/mol. Its IUPAC name is 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one.
Molecular Properties
| Compound Name | 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one |
| PubChem CID | 166645867 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one |
| SMILES | C=C1N(C)C(=O)NC(=S)N1CC |
| InChI | InChI=1S/C7H11N3OS/c1-4-10-5(2)9(3)6(11)8-7(10)12/h2,4H2,1,3H3,(H,8,11,12) |
| InChIKey | PYSYHPDOGVRFSP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one?
The IUPAC name of 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one (CID 166645867) is 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one.
What is the SMILES notation for 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one?
The canonical SMILES for 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one is C=C1N(C)C(=O)NC(=S)N1CC.
What is the InChIKey of 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one?
The InChIKey is PYSYHPDOGVRFSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3OS/c1-4-10-5(2)9(3)6(11)8-7(10)12/h2,4H2,1,3H3,(H,8,11,12).
What are the key properties of 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one?
5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one has a molecular weight of 185.25 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-methyl-6-methylidene-4-sulfanylidene-1,3,5-triazinan-2-one is sourced from PubChem (CID 166645867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).