About (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine
(6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine (PubChem CID 166645957) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine.
Molecular Properties
| Compound Name | (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine |
| PubChem CID | 166645957 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine |
| SMILES | C/C=C1\C(C)N=CCN1C |
| InChI | InChI=1S/C8H14N2/c1-4-8-7(2)9-5-6-10(8)3/h4-5,7H,6H2,1-3H3/b8-4+ |
| InChIKey | KXKAPMDALMEKEC-XBXARRHUSA-N |
| XLogP | 1.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine?
The IUPAC name of (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine (CID 166645957) is (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine.
What is the SMILES notation for (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine?
The canonical SMILES for (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine is C/C=C1\C(C)N=CCN1C.
What is the InChIKey of (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine?
The InChIKey is KXKAPMDALMEKEC-XBXARRHUSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-8-7(2)9-5-6-10(8)3/h4-5,7H,6H2,1-3H3/b8-4+.
What are the key properties of (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine?
(6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine has a molecular weight of 138.21 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-ethylidene-1,5-dimethyl-2,5-dihydropyrazine is sourced from PubChem (CID 166645957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).