C13H16N4O6 — CID 166646079
(6,9-dioxo-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-dien-7-yl)oxymethyl methyl carbonate (PubChem CID 166646079) has the molecular formula C13H16N4O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is (6,9-dioxo-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-dien-7-yl)oxymethyl methyl carbonate.
| Compound Name | (6,9-dioxo-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-dien-7-yl)oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 166646079 |
| Molecular Formula | C13H16N4O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (6,9-dioxo-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-dien-7-yl)oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ncc1=O)CN1CCCCN1C2=O |
| InChI | InChI=1S/C13H16N4O6/c1-21-13(20)23-8-22-11-9(18)6-14-16-7-15-4-2-3-5-17(15)12(19)10(11)16/h6H,2-5,7-8H2,1H3 |
| InChIKey | UHYRYJULFOLOJA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 103.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|