C17H24FN — CID 166646201
(2Z,4Z)-1-(4-fluoro-5,5-dimethylcyclopenta-1,3-dien-1-yl)-N-propan-2-ylhepta-2,4-dien-1-imine (PubChem CID 166646201) has the molecular formula C17H24FN and a molecular weight of 261.38 g/mol. Its IUPAC name is (2Z,4Z)-1-(4-fluoro-5,5-dimethylcyclopenta-1,3-dien-1-yl)-N-propan-2-ylhepta-2,4-dien-1-imine.
| Compound Name | (2Z,4Z)-1-(4-fluoro-5,5-dimethylcyclopenta-1,3-dien-1-yl)-N-propan-2-ylhepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 166646201 |
| Molecular Formula | C17H24FN |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | (2Z,4Z)-1-(4-fluoro-5,5-dimethylcyclopenta-1,3-dien-1-yl)-N-propan-2-ylhepta-2,4-dien-1-imine |
| SMILES | CC/C=C\C=C/C(=N\C(C)C)C1=CC=C(F)C1(C)C |
| InChI | InChI=1S/C17H24FN/c1-6-7-8-9-10-15(19-13(2)3)14-11-12-16(18)17(14,4)5/h7-13H,6H2,1-5H3/b8-7-,10-9-,19-15+ |
| InChIKey | JHTUGXOPHAOTSI-GZNBTKOVSA-N |
| XLogP | 5.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|