About [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate
[(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate (PubChem CID 166646354) has the molecular formula C11H17IN2O6
and a molecular weight of 400.17 g/mol. Its IUPAC name is [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate.
Molecular Properties
| Compound Name | [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate |
| PubChem CID | 166646354 |
| Molecular Formula | C11H17IN2O6 |
| Molecular Weight | 400.17 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate |
| SMILES | CNC(=O)OC1/C=C\C(OC(=O)NI)CC(O)C(O)C1 |
| InChI | InChI=1S/C11H17IN2O6/c1-13-10(17)19-6-2-3-7(20-11(18)14-12)5-9(16)8(15)4-6/h2-3,6-9,15-16H,4-5H2,1H3,(H,13,17)(H,14,18)/b3-2- |
| InChIKey | LCWVKJKSGGSMFE-IHWYPQMZSA-N |
| XLogP | 0.23 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.17 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate?
The IUPAC name of [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate (CID 166646354) is [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate.
What is the SMILES notation for [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate?
The canonical SMILES for [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate is CNC(=O)OC1/C=C\C(OC(=O)NI)CC(O)C(O)C1.
What is the InChIKey of [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate?
The InChIKey is LCWVKJKSGGSMFE-IHWYPQMZSA-N. The full InChI is InChI=1S/C11H17IN2O6/c1-13-10(17)19-6-2-3-7(20-11(18)14-12)5-9(16)8(15)4-6/h2-3,6-9,15-16H,4-5H2,1H3,(H,13,17)(H,14,18)/b3-2-.
What are the key properties of [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate?
[(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate has a molecular weight of 400.17 g/mol, XLogP of 0.23, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-6,7-dihydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-iodocarbamate is sourced from PubChem (CID 166646354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).