C17H28O5 — CID 16664647
methyl 2-[(3aR,6R,6aR)-5-[(Z)-hept-1-enyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate (PubChem CID 16664647) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl 2-[(3aR,6R,6aR)-5-[(Z)-hept-1-enyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate.
| Compound Name | methyl 2-[(3aR,6R,6aR)-5-[(Z)-hept-1-enyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 16664647 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | methyl 2-[(3aR,6R,6aR)-5-[(Z)-hept-1-enyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
| SMILES | CCCCC/C=C\C1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C17H28O5/c1-5-6-7-8-9-10-13-12(11-14(18)19-4)15-16(20-13)22-17(2,3)21-15/h9-10,12-13,15-16H,5-8,11H2,1-4H3/b10-9-/t12-,13?,15-,16-/m1/s1 |
| InChIKey | KJWKGGUAQLOQBK-ACTQEIAASA-N |
| XLogP | 3.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|