C11H18O4 — CID 16664649
(3aR,4R,6R,6aR)-6-hydroxy-4-pentyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one (PubChem CID 16664649) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (3aR,4R,6R,6aR)-6-hydroxy-4-pentyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one.
| Compound Name | (3aR,4R,6R,6aR)-6-hydroxy-4-pentyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
|---|---|
| PubChem CID | 16664649 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (3aR,4R,6R,6aR)-6-hydroxy-4-pentyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
| SMILES | CCCCC[C@H]1O[C@@H](O)[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C11H18O4/c1-2-3-4-5-8-7-6-9(12)15-10(7)11(13)14-8/h7-8,10-11,13H,2-6H2,1H3/t7-,8-,10-,11-/m1/s1 |
| InChIKey | JSYCZHPOWLTEBL-YJFSRANCSA-N |
| XLogP | 1.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|