C12H16N2OS — CID 166646887
(2Z,4E)-2-[ethyl(methyl)amino]-4-methylhepta-2,4,6-trienoyl isothiocyanate (PubChem CID 166646887) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is (2Z,4E)-2-[ethyl(methyl)amino]-4-methylhepta-2,4,6-trienoyl isothiocyanate.
| Compound Name | (2Z,4E)-2-[ethyl(methyl)amino]-4-methylhepta-2,4,6-trienoyl isothiocyanate |
|---|---|
| PubChem CID | 166646887 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (2Z,4E)-2-[ethyl(methyl)amino]-4-methylhepta-2,4,6-trienoyl isothiocyanate |
| SMILES | C=C/C=C(C)/C=C(/C(=O)N=C=S)N(C)CC |
| InChI | InChI=1S/C12H16N2OS/c1-5-7-10(3)8-11(14(4)6-2)12(15)13-9-16/h5,7-8H,1,6H2,2-4H3/b10-7+,11-8- |
| InChIKey | IPRYYPROHFKWJA-WAKDDQPJSA-N |
| XLogP | 2.58 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|