C14H23ClN2O — CID 166647270
1-[(3Z,5E)-5-chloro-4-methoxynona-1,3,5-trien-3-yl]piperazine (PubChem CID 166647270) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is 1-[(3Z,5E)-5-chloro-4-methoxynona-1,3,5-trien-3-yl]piperazine.
| Compound Name | 1-[(3Z,5E)-5-chloro-4-methoxynona-1,3,5-trien-3-yl]piperazine |
|---|---|
| PubChem CID | 166647270 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-[(3Z,5E)-5-chloro-4-methoxynona-1,3,5-trien-3-yl]piperazine |
| SMILES | C=C/C(=C(OC)\C(Cl)=C/CCC)N1CCNCC1 |
| InChI | InChI=1S/C14H23ClN2O/c1-4-6-7-12(15)14(18-3)13(5-2)17-10-8-16-9-11-17/h5,7,16H,2,4,6,8-11H2,1,3H3/b12-7+,14-13- |
| InChIKey | QRSDQGCXGCDNCZ-QSYVVUFSSA-N |
| XLogP | 2.86 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|