About 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine
3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine (PubChem CID 166647314) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine |
| PubChem CID | 166647314 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CC1CSC(CCCN(C)C)C1C |
| InChI | InChI=1S/C11H23NS/c1-9-8-13-11(10(9)2)6-5-7-12(3)4/h9-11H,5-8H2,1-4H3 |
| InChIKey | BPAMOCSRALTVMF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine (CID 166647314) is 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine is CC1CSC(CCCN(C)C)C1C.
What is the InChIKey of 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine?
The InChIKey is BPAMOCSRALTVMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NS/c1-9-8-13-11(10(9)2)6-5-7-12(3)4/h9-11H,5-8H2,1-4H3.
What are the key properties of 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine?
3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine has a molecular weight of 201.38 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylthiolan-2-yl)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 166647314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).