C20H25N11O2 — CID 166647458
N'-[amino(methyl)amino]-2-methoxy-3-[[2-methyl-6-[(1-methylpyrazol-3-yl)amino]-3-oxo-1H-pyrazolo[3,4-b]pyridin-4-yl]amino]benzenecarboximidamide (PubChem CID 166647458) has the molecular formula C20H25N11O2 and a molecular weight of 451.50 g/mol. Its IUPAC name is N'-[amino(methyl)amino]-2-methoxy-3-[[2-methyl-6-[(1-methylpyrazol-3-yl)amino]-3-oxo-1H-pyrazolo[3,4-b]pyridin-4-yl]amino]benzenecarboximidamide.
| Compound Name | N'-[amino(methyl)amino]-2-methoxy-3-[[2-methyl-6-[(1-methylpyrazol-3-yl)amino]-3-oxo-1H-pyrazolo[3,4-b]pyridin-4-yl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 166647458 |
| Molecular Formula | C20H25N11O2 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | N'-[amino(methyl)amino]-2-methoxy-3-[[2-methyl-6-[(1-methylpyrazol-3-yl)amino]-3-oxo-1H-pyrazolo[3,4-b]pyridin-4-yl]amino]benzenecarboximidamide |
| SMILES | COc1c(Nc2cc(Nc3ccn(C)n3)nc3[nH]n(C)c(=O)c23)cccc1/C(N)=N/N(C)N |
| InChI | InChI=1S/C20H25N11O2/c1-29-9-8-14(26-29)24-15-10-13(16-19(25-15)28-30(2)20(16)32)23-12-7-5-6-11(17(12)33-4)18(21)27-31(3)22/h5-10H,22H2,1-4H3,(H2,21,27)(H3,23,24,25,26,28) |
| InChIKey | RDAGGANJANLRTH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|