C15H24O5 — CID 16664771
methyl 2-[(3aR,6R,6aR)-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate (PubChem CID 16664771) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is methyl 2-[(3aR,6R,6aR)-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate.
| Compound Name | methyl 2-[(3aR,6R,6aR)-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 16664771 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | methyl 2-[(3aR,6R,6aR)-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
| SMILES | CCC/C=C\C1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C15H24O5/c1-5-6-7-8-11-10(9-12(16)17-4)13-14(18-11)20-15(2,3)19-13/h7-8,10-11,13-14H,5-6,9H2,1-4H3/b8-7-/t10-,11?,13-,14-/m1/s1 |
| InChIKey | DWSGPPZYHGJJQD-PBPFVULBSA-N |
| XLogP | 2.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|