C13H22O4 — CID 16664774
(3aR,4R,6R,6aR)-4-heptyl-6-hydroxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one (PubChem CID 16664774) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (3aR,4R,6R,6aR)-4-heptyl-6-hydroxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one.
| Compound Name | (3aR,4R,6R,6aR)-4-heptyl-6-hydroxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
|---|---|
| PubChem CID | 16664774 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (3aR,4R,6R,6aR)-4-heptyl-6-hydroxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
| SMILES | CCCCCCC[C@H]1O[C@@H](O)[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C13H22O4/c1-2-3-4-5-6-7-10-9-8-11(14)17-12(9)13(15)16-10/h9-10,12-13,15H,2-8H2,1H3/t9-,10-,12-,13-/m1/s1 |
| InChIKey | ZLEPBFUZYRBMLU-FPQZTECRSA-N |
| XLogP | 2.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|