C19H10O4 — CID 16664788
6,7-dihydroxy-3-oxapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaen-11-one (PubChem CID 16664788) has the molecular formula C19H10O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is 6,7-dihydroxy-3-oxapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaen-11-one.
| Compound Name | 6,7-dihydroxy-3-oxapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaen-11-one |
|---|---|
| PubChem CID | 16664788 |
| Molecular Formula | C19H10O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 6,7-dihydroxy-3-oxapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaen-11-one |
| SMILES | O=C1c2c(oc3cc(O)c(O)cc23)-c2cccc3cccc1c23 |
| InChI | InChI=1S/C19H10O4/c20-13-7-12-15(8-14(13)21)23-19-11-6-2-4-9-3-1-5-10(16(9)11)18(22)17(12)19/h1-8,20-21H |
| InChIKey | VFKSMESKAIQKBL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|