About (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile
(7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile (PubChem CID 166648044) has the molecular formula C8H11F3N2
and a molecular weight of 192.18 g/mol. Its IUPAC name is (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile.
Molecular Properties
| Compound Name | (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile |
| PubChem CID | 166648044 |
| Molecular Formula | C8H11F3N2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile |
| SMILES | N#CC1C(F)C(N)CCC(F)[C@@H]1F |
| InChI | InChI=1S/C8H11F3N2/c9-5-1-2-6(13)8(11)4(3-12)7(5)10/h4-8H,1-2,13H2/t4?,5?,6?,7-,8?/m1/s1 |
| InChIKey | DJBVOMGSDBUAHH-HNVBXDBXSA-N |
| XLogP | 1.26 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile?
The IUPAC name of (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile (CID 166648044) is (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile.
What is the SMILES notation for (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile?
The canonical SMILES for (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile is N#CC1C(F)C(N)CCC(F)[C@@H]1F.
What is the InChIKey of (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile?
The InChIKey is DJBVOMGSDBUAHH-HNVBXDBXSA-N. The full InChI is InChI=1S/C8H11F3N2/c9-5-1-2-6(13)8(11)4(3-12)7(5)10/h4-8H,1-2,13H2/t4?,5?,6?,7-,8?/m1/s1.
What are the key properties of (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile?
(7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile has a molecular weight of 192.18 g/mol, XLogP of 1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-3-amino-2,6,7-trifluorocycloheptane-1-carbonitrile is sourced from PubChem (CID 166648044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).