C36H40F2N2 — CID 166648067
N-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-4-[4-[(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)amino]-6-fluorocyclohex-2-en-1-yl]-3-fluorocyclohexa-2,4-dien-1-amine (PubChem CID 166648067) has the molecular formula C36H40F2N2 and a molecular weight of 538.73 g/mol. Its IUPAC name is N-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-4-[4-[(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)amino]-6-fluorocyclohex-2-en-1-yl]-3-fluorocyclohexa-2,4-dien-1-amine.
| Compound Name | N-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-4-[4-[(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)amino]-6-fluorocyclohex-2-en-1-yl]-3-fluorocyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 166648067 |
| Molecular Formula | C36H40F2N2 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | N-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-4-[4-[(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)amino]-6-fluorocyclohex-2-en-1-yl]-3-fluorocyclohexa-2,4-dien-1-amine |
| SMILES | FC1=CC(NC2=CC=C(C3=CC=CCC3)CC2)CC=C1C1C=CC(NC2=CC=C(C3=CC=CCC3)CC2)CC1F |
| InChI | InChI=1S/C36H40F2N2/c37-35-23-31(39-29-15-11-27(12-16-29)25-7-3-1-4-8-25)19-21-33(35)34-22-20-32(24-36(34)38)40-30-17-13-28(14-18-30)26-9-5-2-6-10-26/h1-3,5,7,9,11,13,15,17,19,21-22,24,31-33,35,39-40H,4,6,8,10,12,14,16,18,20,23H2 |
| InChIKey | PGLHZMQQFXLMJM-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|