About 3-ethyl-N-methyl-1,2-benzoxazol-5-amine
3-ethyl-N-methyl-1,2-benzoxazol-5-amine (PubChem CID 166648258) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-ethyl-N-methyl-1,2-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 3-ethyl-N-methyl-1,2-benzoxazol-5-amine |
| PubChem CID | 166648258 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-ethyl-N-methyl-1,2-benzoxazol-5-amine |
| SMILES | CCc1noc2ccc(NC)cc12 |
| InChI | InChI=1S/C10H12N2O/c1-3-9-8-6-7(11-2)4-5-10(8)13-12-9/h4-6,11H,3H2,1-2H3 |
| InChIKey | KSUPHYBNLWVFFZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-N-methyl-1,2-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N-methyl-1,2-benzoxazol-5-amine?
The IUPAC name of 3-ethyl-N-methyl-1,2-benzoxazol-5-amine (CID 166648258) is 3-ethyl-N-methyl-1,2-benzoxazol-5-amine.
What is the SMILES notation for 3-ethyl-N-methyl-1,2-benzoxazol-5-amine?
The canonical SMILES for 3-ethyl-N-methyl-1,2-benzoxazol-5-amine is CCc1noc2ccc(NC)cc12.
What is the InChIKey of 3-ethyl-N-methyl-1,2-benzoxazol-5-amine?
The InChIKey is KSUPHYBNLWVFFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-3-9-8-6-7(11-2)4-5-10(8)13-12-9/h4-6,11H,3H2,1-2H3.
What are the key properties of 3-ethyl-N-methyl-1,2-benzoxazol-5-amine?
3-ethyl-N-methyl-1,2-benzoxazol-5-amine has a molecular weight of 176.22 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N-methyl-1,2-benzoxazol-5-amine is sourced from PubChem (CID 166648258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).