C23H23F5N6O3 — CID 166648374
2-[2-[2-[3-(difluoromethoxy)-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]ethyl]-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]propan-2-ol (PubChem CID 166648374) has the molecular formula C23H23F5N6O3 and a molecular weight of 526.47 g/mol. Its IUPAC name is 2-[2-[2-[3-(difluoromethoxy)-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]ethyl]-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]propan-2-ol.
| Compound Name | 2-[2-[2-[3-(difluoromethoxy)-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]ethyl]-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]propan-2-ol |
|---|---|
| PubChem CID | 166648374 |
| Molecular Formula | C23H23F5N6O3 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 2-[2-[2-[3-(difluoromethoxy)-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]ethyl]-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]propan-2-ol |
| SMILES | Cc1ncn(-c2ccc(CCc3nc4c(C(C)(C)O)ccc(OCC(F)(F)F)n4n3)cc2OC(F)F)n1 |
| InChI | InChI=1S/C23H23F5N6O3/c1-13-29-12-33(31-13)16-7-4-14(10-17(16)37-21(24)25)5-8-18-30-20-15(22(2,3)35)6-9-19(34(20)32-18)36-11-23(26,27)28/h4,6-7,9-10,12,21,35H,5,8,11H2,1-3H3 |
| InChIKey | LOVDJGFFKVHCDB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |