C22H20FN7O2 — CID 166648401
5-cyclopropylimino-9-[1-[(2-fluorophenyl)methyl]-5-methoxypyrazol-3-yl]-4-methyl-2,6,8,10-tetrazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-3-one (PubChem CID 166648401) has the molecular formula C22H20FN7O2 and a molecular weight of 433.45 g/mol. Its IUPAC name is 5-cyclopropylimino-9-[1-[(2-fluorophenyl)methyl]-5-methoxypyrazol-3-yl]-4-methyl-2,6,8,10-tetrazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-3-one.
| Compound Name | 5-cyclopropylimino-9-[1-[(2-fluorophenyl)methyl]-5-methoxypyrazol-3-yl]-4-methyl-2,6,8,10-tetrazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-3-one |
|---|---|
| PubChem CID | 166648401 |
| Molecular Formula | C22H20FN7O2 |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 5-cyclopropylimino-9-[1-[(2-fluorophenyl)methyl]-5-methoxypyrazol-3-yl]-4-methyl-2,6,8,10-tetrazatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-3-one |
| SMILES | COc1cc(-c2nc3c4c(n2)N/C(=N\C2CC2)C4(C)C(=O)N3)nn1Cc1ccccc1F |
| InChI | InChI=1S/C22H20FN7O2/c1-22-16-18(27-20(22)24-12-7-8-12)25-17(26-19(16)28-21(22)31)14-9-15(32-2)30(29-14)10-11-5-3-4-6-13(11)23/h3-6,9,12H,7-8,10H2,1-2H3,(H2,24,25,26,27,28,31) |
| InChIKey | FCLLHWZTEFHBIP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|