C14H23NO — CID 166648438
5-methoxy-N,N-dipropylcyclohepta-1,4,6-trien-1-amine (PubChem CID 166648438) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 5-methoxy-N,N-dipropylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | 5-methoxy-N,N-dipropylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 166648438 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 5-methoxy-N,N-dipropylcyclohepta-1,4,6-trien-1-amine |
| SMILES | CCCN(CCC)C1=CCC=C(OC)C=C1 |
| InChI | InChI=1S/C14H23NO/c1-4-11-15(12-5-2)13-7-6-8-14(16-3)10-9-13/h7-10H,4-6,11-12H2,1-3H3 |
| InChIKey | COZBUJSCMYFEIP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |