C11H14F3N — CID 166648532
(3Z,5E)-3-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)hepta-3,5-dien-2-imine (PubChem CID 166648532) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is (3Z,5E)-3-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)hepta-3,5-dien-2-imine.
| Compound Name | (3Z,5E)-3-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 166648532 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (3Z,5E)-3-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)hepta-3,5-dien-2-imine |
| SMILES | C=C(/N=C(C)/C(C)=C\C=C\C)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N/c1-5-6-7-8(2)9(3)15-10(4)11(12,13)14/h5-7H,4H2,1-3H3/b6-5+,8-7-,15-9+ |
| InChIKey | YQDWFIQTLNUUKP-HZXDVELOSA-N |
| XLogP | 4.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|